C20H30F3NO — CID 51117791
N-[1-(1-adamantyl)ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 51117791) has the molecular formula C20H30F3NO and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 51117791 |
| Molecular Formula | C20H30F3NO |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(NC(=O)C1CCCCC1C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H30F3NO/c1-12(19-9-13-6-14(10-19)8-15(7-13)11-19)24-18(25)16-4-2-3-5-17(16)20(21,22)23/h12-17H,2-11H2,1H3,(H,24,25) |
| InChIKey | UVDKLLVBUOHGPL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |