C13H21ClF3NO — CID 113434021
N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 113434021) has the molecular formula C13H21ClF3NO and a molecular weight of 299.76 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 113434021 |
| Molecular Formula | C13H21ClF3NO |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)C(CCl)NC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H21ClF3NO/c1-8(2)11(7-14)18-12(19)9-5-3-4-6-10(9)13(15,16)17/h8-11H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | JWHGUQLMPYHRSA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|