C13H21BrF3NO — CID 113497940
N-(3-bromopentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 113497940) has the molecular formula C13H21BrF3NO and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(3-bromopentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-bromopentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 113497940 |
| Molecular Formula | C13H21BrF3NO |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(3-bromopentyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCC(Br)CCNC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H21BrF3NO/c1-2-9(14)7-8-18-12(19)10-5-3-4-6-11(10)13(15,16)17/h9-11H,2-8H2,1H3,(H,18,19) |
| InChIKey | WHGBLTRAGOMUPM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|