C14H20F3NO3 — CID 103978245
2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103978245) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103978245 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO3/c15-14(16,17)10-6-1-2-7-11(10)18-12(19)8-4-3-5-9(8)13(20)21/h8-11H,1-7H2,(H,18,19)(H,20,21) |
| InChIKey | KZHCRRBZWBCZGH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |