C12H17ClF3NO3S — CID 104622347
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104622347) has the molecular formula C12H17ClF3NO3S and a molecular weight of 347.79 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104622347 |
| Molecular Formula | C12H17ClF3NO3S |
| Molecular Weight | 347.79 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CS(=O)(=O)CC1Cl)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H17ClF3NO3S/c13-9-5-21(19,20)6-10(9)17-11(18)7-3-1-2-4-8(7)12(14,15)16/h7-10H,1-6H2,(H,17,18) |
| InChIKey | ZNLNUSXGHVIFQR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.79 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|