C14H21BrF3NO — CID 104622785
N-(4-bromocyclohexyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104622785) has the molecular formula C14H21BrF3NO and a molecular weight of 356.23 g/mol. Its IUPAC name is N-(4-bromocyclohexyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-bromocyclohexyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104622785 |
| Molecular Formula | C14H21BrF3NO |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(4-bromocyclohexyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CCC(Br)CC1)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H21BrF3NO/c15-9-5-7-10(8-6-9)19-13(20)11-3-1-2-4-12(11)14(16,17)18/h9-12H,1-8H2,(H,19,20) |
| InChIKey | BDLGMAGMOBLYKB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|