C12H16F3NO3 — CID 54868352
2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 54868352) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54868352 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[[2-(trifluoromethyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3/c13-12(14,15)8-3-1-2-4-9(8)16-10(17)6-5-7(6)11(18)19/h6-9H,1-5H2,(H,16,17)(H,18,19) |
| InChIKey | RYALQSAEYJMMSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |