C12H19F3N2O3 — CID 64895229
4-amino-5-oxo-5-[[2-(trifluoromethyl)cyclohexyl]amino]pentanoic acid (PubChem CID 64895229) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-amino-5-oxo-5-[[2-(trifluoromethyl)cyclohexyl]amino]pentanoic acid.
| Compound Name | 4-amino-5-oxo-5-[[2-(trifluoromethyl)cyclohexyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 64895229 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-amino-5-oxo-5-[[2-(trifluoromethyl)cyclohexyl]amino]pentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O3/c13-12(14,15)7-3-1-2-4-9(7)17-11(20)8(16)5-6-10(18)19/h7-9H,1-6,16H2,(H,17,20)(H,18,19) |
| InChIKey | UQWXWEMRXYYLKE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |