C13H23F3N2O — CID 61177900
(2S)-2-amino-4-methyl-N-[2-(trifluoromethyl)cyclohexyl]pentanamide (PubChem CID 61177900) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[2-(trifluoromethyl)cyclohexyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[2-(trifluoromethyl)cyclohexyl]pentanamide |
|---|---|
| PubChem CID | 61177900 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[2-(trifluoromethyl)cyclohexyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O/c1-8(2)7-10(17)12(19)18-11-6-4-3-5-9(11)13(14,15)16/h8-11H,3-7,17H2,1-2H3,(H,18,19)/t9?,10-,11?/m0/s1 |
| InChIKey | ORLOVJFLQPKJBI-YVNMAJEFSA-N |
| XLogP | 2.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |