C12H24N2O3 — CID 59921664
(2R)-2-amino-N-[(3S,4R)-3-hydroxyoxepan-4-yl]-4-methylpentanamide (PubChem CID 59921664) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2R)-2-amino-N-[(3S,4R)-3-hydroxyoxepan-4-yl]-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-[(3S,4R)-3-hydroxyoxepan-4-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 59921664 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2R)-2-amino-N-[(3S,4R)-3-hydroxyoxepan-4-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)N[C@@H]1CCCOC[C@H]1O |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)6-9(13)12(16)14-10-4-3-5-17-7-11(10)15/h8-11,15H,3-7,13H2,1-2H3,(H,14,16)/t9-,10-,11-/m1/s1 |
| InChIKey | WVMOPWXSIXWYHH-GMTAPVOTSA-N |
| XLogP | 0.02 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |