C19H31N3O2 — CID 69145893
(2S)-2-amino-N-(1-benzyl-3-hydroxyazepan-4-yl)-4-methylpentanamide (PubChem CID 69145893) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (2S)-2-amino-N-(1-benzyl-3-hydroxyazepan-4-yl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(1-benzyl-3-hydroxyazepan-4-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 69145893 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (2S)-2-amino-N-(1-benzyl-3-hydroxyazepan-4-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC1CCCN(Cc2ccccc2)CC1O |
| InChI | InChI=1S/C19H31N3O2/c1-14(2)11-16(20)19(24)21-17-9-6-10-22(13-18(17)23)12-15-7-4-3-5-8-15/h3-5,7-8,14,16-18,23H,6,9-13,20H2,1-2H3,(H,21,24)/t16-,17?,18?/m0/s1 |
| InChIKey | RIQUIYQTTZIVIZ-AOCRQIFASA-N |
| XLogP | 1.50 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |