C12H21F3N2OS — CID 61177899
(2S)-2-amino-4-methylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]butanamide (PubChem CID 61177899) has the molecular formula C12H21F3N2OS and a molecular weight of 298.37 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 61177899 |
| Molecular Formula | C12H21F3N2OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2OS/c1-19-7-6-9(16)11(18)17-10-5-3-2-4-8(10)12(13,14)15/h8-10H,2-7,16H2,1H3,(H,17,18)/t8?,9-,10?/m0/s1 |
| InChIKey | JRHXEFQXHBIROT-KYHHOPLUSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |