C12H25ClN2OS2 — CID 119343697
(2S)-2-amino-N-(2-ethylsulfanylcyclopentyl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119343697) has the molecular formula C12H25ClN2OS2 and a molecular weight of 312.93 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-ethylsulfanylcyclopentyl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(2-ethylsulfanylcyclopentyl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119343697 |
| Molecular Formula | C12H25ClN2OS2 |
| Molecular Weight | 312.93 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-2-amino-N-(2-ethylsulfanylcyclopentyl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CCSC1CCCC1NC(=O)[C@@H](N)CCSC.Cl |
| InChI | InChI=1S/C12H24N2OS2.ClH/c1-3-17-11-6-4-5-10(11)14-12(15)9(13)7-8-16-2;/h9-11H,3-8,13H2,1-2H3,(H,14,15);1H/t9-,10?,11?;/m0./s1 |
| InChIKey | DAFQFJOFYQRVDM-IGUXDCQPSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.93 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |