C9H15NO5S — CID 104517400
3-[(1,1-dioxothiane-2-carbonyl)amino]propanoic acid (PubChem CID 104517400) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is 3-[(1,1-dioxothiane-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(1,1-dioxothiane-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 104517400 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-[(1,1-dioxothiane-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H15NO5S/c11-8(12)4-5-10-9(13)7-3-1-2-6-16(7,14)15/h7H,1-6H2,(H,10,13)(H,11,12) |
| InChIKey | WPOXEEZZAXPBQD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |