C12H23N3O3S — CID 104517894
1,1-dioxo-N-(2-piperazin-1-ylethyl)thiane-2-carboxamide (PubChem CID 104517894) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1,1-dioxo-N-(2-piperazin-1-ylethyl)thiane-2-carboxamide.
| Compound Name | 1,1-dioxo-N-(2-piperazin-1-ylethyl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 104517894 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1,1-dioxo-N-(2-piperazin-1-ylethyl)thiane-2-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H23N3O3S/c16-12(11-3-1-2-10-19(11,17)18)14-6-9-15-7-4-13-5-8-15/h11,13H,1-10H2,(H,14,16) |
| InChIKey | RLFBBBRCUJAARS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |