C12H22N4O4S — CID 108517864
N'-(1,1-dioxothiolan-3-yl)-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517864) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517864 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCNCC1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N4O4S/c17-11(14-4-7-16-5-2-13-3-6-16)12(18)15-10-1-8-21(19,20)9-10/h10,13H,1-9H2,(H,14,17)(H,15,18) |
| InChIKey | HMANMUCHBGREBN-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|