C13H26N4O3S — CID 95134797
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea (PubChem CID 95134797) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 95134797 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea |
| SMILES | CCN1CCN(CCNC(=O)N[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H26N4O3S/c1-2-16-6-8-17(9-7-16)5-4-14-13(18)15-12-3-10-21(19,20)11-12/h12H,2-11H2,1H3,(H2,14,15,18)/t12-/m1/s1 |
| InChIKey | IRESMYKDEDDCAO-GFCCVEGCSA-N |
| XLogP | -0.89 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |