C12H22N2O3S — CID 104522509
N-[(2-aminocyclopentyl)methyl]-1,1-dioxothiane-2-carboxamide (PubChem CID 104522509) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[(2-aminocyclopentyl)methyl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[(2-aminocyclopentyl)methyl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104522509 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[(2-aminocyclopentyl)methyl]-1,1-dioxothiane-2-carboxamide |
| SMILES | NC1CCCC1CNC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H22N2O3S/c13-10-5-3-4-9(10)8-14-12(15)11-6-1-2-7-18(11,16)17/h9-11H,1-8,13H2,(H,14,15) |
| InChIKey | VYMKLXVABCRSRJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |