C13H24N2O3S — CID 114699924
N-[(3-methylpiperidin-4-yl)methyl]-1,1-dioxothiane-2-carboxamide (PubChem CID 114699924) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is N-[(3-methylpiperidin-4-yl)methyl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[(3-methylpiperidin-4-yl)methyl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 114699924 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(3-methylpiperidin-4-yl)methyl]-1,1-dioxothiane-2-carboxamide |
| SMILES | CC1CNCCC1CNC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H24N2O3S/c1-10-8-14-6-5-11(10)9-15-13(16)12-4-2-3-7-19(12,17)18/h10-12,14H,2-9H2,1H3,(H,15,16) |
| InChIKey | SKYHACXYSNNKBN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |