C12H18N2O3S3 — CID 80595560
N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiane-2-carboxamide (PubChem CID 80595560) has the molecular formula C12H18N2O3S3 and a molecular weight of 334.49 g/mol. Its IUPAC name is N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiane-2-carboxamide.
| Compound Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiane-2-carboxamide |
|---|---|
| PubChem CID | 80595560 |
| Molecular Formula | C12H18N2O3S3 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]thiane-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)C2CCCCS2)s1 |
| InChI | InChI=1S/C12H18N2O3S3/c13-20(16,17)11-5-4-9(19-11)6-7-14-12(15)10-3-1-2-8-18-10/h4-5,10H,1-3,6-8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | GRRBRTQYIKNBDZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |