C9H14N2O4S3 — CID 64554947
5-[2-(cyclopropylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 64554947) has the molecular formula C9H14N2O4S3 and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-[2-(cyclopropylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[2-(cyclopropylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 64554947 |
| Molecular Formula | C9H14N2O4S3 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 5-[2-(cyclopropylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)C2CC2)s1 |
| InChI | InChI=1S/C9H14N2O4S3/c10-17(12,13)9-4-1-7(16-9)5-6-11-18(14,15)8-2-3-8/h1,4,8,11H,2-3,5-6H2,(H2,10,12,13) |
| InChIKey | XCCVDLXXZGPJGL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |