C10H19N3O4S3 — CID 61454031
5-[2-[[methyl(propan-2-yl)sulfamoyl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 61454031) has the molecular formula C10H19N3O4S3 and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-[2-[[methyl(propan-2-yl)sulfamoyl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[2-[[methyl(propan-2-yl)sulfamoyl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61454031 |
| Molecular Formula | C10H19N3O4S3 |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 5-[2-[[methyl(propan-2-yl)sulfamoyl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CC(C)N(C)S(=O)(=O)NCCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C10H19N3O4S3/c1-8(2)13(3)20(16,17)12-7-6-9-4-5-10(18-9)19(11,14)15/h4-5,8,12H,6-7H2,1-3H3,(H2,11,14,15) |
| InChIKey | YQBJMRFEWZKSAQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |