C9H16N2O5S3 — CID 55014443
5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 55014443) has the molecular formula C9H16N2O5S3 and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55014443 |
| Molecular Formula | C9H16N2O5S3 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | COCCS(=O)(=O)NCCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H16N2O5S3/c1-16-6-7-18(12,13)11-5-4-8-2-3-9(17-8)19(10,14)15/h2-3,11H,4-7H2,1H3,(H2,10,14,15) |
| InChIKey | JYXIIKYANYQCPH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |