C9H14ClNO5S3 — CID 55014305
5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride (PubChem CID 55014305) has the molecular formula C9H14ClNO5S3 and a molecular weight of 347.87 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 55014305 |
| Molecular Formula | C9H14ClNO5S3 |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 5-[2-(2-methoxyethylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride |
| SMILES | COCCS(=O)(=O)NCCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C9H14ClNO5S3/c1-16-6-7-18(12,13)11-5-4-8-2-3-9(17-8)19(10,14)15/h2-3,11H,4-7H2,1H3 |
| InChIKey | JJTKEYFPDPBANI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |