C9H14ClNO4S3 — CID 63687488
5-[(tert-butylsulfonylamino)methyl]thiophene-2-sulfonyl chloride (PubChem CID 63687488) has the molecular formula C9H14ClNO4S3 and a molecular weight of 331.87 g/mol. Its IUPAC name is 5-[(tert-butylsulfonylamino)methyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[(tert-butylsulfonylamino)methyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 63687488 |
| Molecular Formula | C9H14ClNO4S3 |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 5-[(tert-butylsulfonylamino)methyl]thiophene-2-sulfonyl chloride |
| SMILES | CC(C)(C)S(=O)(=O)NCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C9H14ClNO4S3/c1-9(2,3)18(14,15)11-6-7-4-5-8(16-7)17(10,12)13/h4-5,11H,6H2,1-3H3 |
| InChIKey | RDULQYXYGQDAPR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |