C10H14ClNO3S2 — CID 65368095
5-[2-(2-methylpropylamino)-2-oxoethyl]thiophene-2-sulfonyl chloride (PubChem CID 65368095) has the molecular formula C10H14ClNO3S2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 5-[2-(2-methylpropylamino)-2-oxoethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(2-methylpropylamino)-2-oxoethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65368095 |
| Molecular Formula | C10H14ClNO3S2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 5-[2-(2-methylpropylamino)-2-oxoethyl]thiophene-2-sulfonyl chloride |
| SMILES | CC(C)CNC(=O)Cc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C10H14ClNO3S2/c1-7(2)6-12-9(13)5-8-3-4-10(16-8)17(11,14)15/h3-4,7H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | ZZXDJLCLXQGBCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |