C9H11ClO4S2 — CID 65395765
propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate (PubChem CID 65395765) has the molecular formula C9H11ClO4S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate.
| Compound Name | propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 65395765 |
| Molecular Formula | C9H11ClO4S2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate |
| SMILES | CCCOC(=O)Cc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C9H11ClO4S2/c1-2-5-14-8(11)6-7-3-4-9(15-7)16(10,12)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | IIHVHOKKSSXBNN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |