propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate

C9H11ClO4S2 — CID 65395765

IUPACpropyl 2-(5-chlorosulfonylthiophen-2-yl)acetate
SMILESCCCOC(=O)Cc1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C9H11ClO4S2/c1-2-5-14-8(11)6-7-3-4-9(15-7)16(10,12)13/h3-4H,2,5-6H2,1H3
InChIKeyIIHVHOKKSSXBNN-UHFFFAOYSA-N
MW282.77 g/mol
LogP2.17
Rot. Bonds5

About propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate

propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate (PubChem CID 65395765) has the molecular formula C9H11ClO4S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate.

Molecular Properties

Compound Namepropyl 2-(5-chlorosulfonylthiophen-2-yl)acetate
PubChem CID65395765
Molecular FormulaC9H11ClO4S2
Molecular Weight282.77 g/mol
Exact Mass281.98
IUPAC Namepropyl 2-(5-chlorosulfonylthiophen-2-yl)acetate
SMILESCCCOC(=O)Cc1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C9H11ClO4S2/c1-2-5-14-8(11)6-7-3-4-9(15-7)16(10,12)13/h3-4H,2,5-6H2,1H3
InChIKeyIIHVHOKKSSXBNN-UHFFFAOYSA-N
XLogP2.17
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.77
LogP ≤ 52.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The IUPAC name of propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate (CID 65395765) is propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate.
What is the SMILES notation for propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The canonical SMILES for propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate is CCCOC(=O)Cc1ccc(S(=O)(=O)Cl)s1.
What is the InChIKey of propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The InChIKey is IIHVHOKKSSXBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO4S2/c1-2-5-14-8(11)6-7-3-4-9(15-7)16(10,12)13/h3-4H,2,5-6H2,1H3.
What are the key properties of propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate?
propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate has a molecular weight of 282.77 g/mol, XLogP of 2.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(5-chlorosulfonylthiophen-2-yl)acetate is sourced from PubChem (CID 65395765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).