(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate

C14H19ClO4S2 — CID 65397741

IUPAC(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate
SMILESCCC1CCCCC1OC(=O)Cc1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C14H19ClO4S2/c1-2-10-5-3-4-6-12(10)19-13(16)9-11-7-8-14(20-11)21(15,17)18/h7-8,10,12H,2-6,9H2,1H3
InChIKeyPBQUMWITAGTHOU-UHFFFAOYSA-N
MW350.89 g/mol
LogP3.73
Rot. Bonds5

About (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate

(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate (PubChem CID 65397741) has the molecular formula C14H19ClO4S2 and a molecular weight of 350.89 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate.

Molecular Properties

Compound Name(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate
PubChem CID65397741
Molecular FormulaC14H19ClO4S2
Molecular Weight350.89 g/mol
Exact Mass350.04
IUPAC Name(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate
SMILESCCC1CCCCC1OC(=O)Cc1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C14H19ClO4S2/c1-2-10-5-3-4-6-12(10)19-13(16)9-11-7-8-14(20-11)21(15,17)18/h7-8,10,12H,2-6,9H2,1H3
InChIKeyPBQUMWITAGTHOU-UHFFFAOYSA-N
XLogP3.73
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.89
LogP ≤ 53.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The IUPAC name of (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate (CID 65397741) is (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate.
What is the SMILES notation for (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The canonical SMILES for (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate is CCC1CCCCC1OC(=O)Cc1ccc(S(=O)(=O)Cl)s1.
What is the InChIKey of (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate?
The InChIKey is PBQUMWITAGTHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO4S2/c1-2-10-5-3-4-6-12(10)19-13(16)9-11-7-8-14(20-11)21(15,17)18/h7-8,10,12H,2-6,9H2,1H3.
What are the key properties of (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate?
(2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate has a molecular weight of 350.89 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 2-(5-chlorosulfonylthiophen-2-yl)acetate is sourced from PubChem (CID 65397741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).