About (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate
(2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate (PubChem CID 65397739) has the molecular formula C13H16BrClO5S
and a molecular weight of 399.69 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate.
Molecular Properties
| Compound Name | (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate |
| PubChem CID | 65397739 |
| Molecular Formula | C13H16BrClO5S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate |
| SMILES | CCC1CCCCC1OC(=O)c1cc(S(=O)(=O)Cl)c(Br)o1 |
| InChI | InChI=1S/C13H16BrClO5S/c1-2-8-5-3-4-6-9(8)20-13(16)10-7-11(12(14)19-10)21(15,17)18/h7-9H,2-6H2,1H3 |
| InChIKey | UQYJWTGGCHZROF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate?
The IUPAC name of (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate (CID 65397739) is (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate.
What is the SMILES notation for (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate?
The canonical SMILES for (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate is CCC1CCCCC1OC(=O)c1cc(S(=O)(=O)Cl)c(Br)o1.
What is the InChIKey of (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate?
The InChIKey is UQYJWTGGCHZROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrClO5S/c1-2-8-5-3-4-6-9(8)20-13(16)10-7-11(12(14)19-10)21(15,17)18/h7-9H,2-6H2,1H3.
What are the key properties of (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate?
(2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate has a molecular weight of 399.69 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 5-bromo-4-chlorosulfonylfuran-2-carboxylate is sourced from PubChem (CID 65397739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).