C10H11ClO4S2 — CID 65373367
cyclobutyl 2-(5-chlorosulfonylthiophen-2-yl)acetate (PubChem CID 65373367) has the molecular formula C10H11ClO4S2 and a molecular weight of 294.78 g/mol. Its IUPAC name is cyclobutyl 2-(5-chlorosulfonylthiophen-2-yl)acetate.
| Compound Name | cyclobutyl 2-(5-chlorosulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 65373367 |
| Molecular Formula | C10H11ClO4S2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | cyclobutyl 2-(5-chlorosulfonylthiophen-2-yl)acetate |
| SMILES | O=C(Cc1ccc(S(=O)(=O)Cl)s1)OC1CCC1 |
| InChI | InChI=1S/C10H11ClO4S2/c11-17(13,14)10-5-4-8(16-10)6-9(12)15-7-2-1-3-7/h4-5,7H,1-3,6H2 |
| InChIKey | AUEFHGCZJUOGTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |