C14H23NO4S2 — CID 58942892
propyl 2-[5-[(butylsulfonylamino)methyl]thiophen-2-yl]acetate (PubChem CID 58942892) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is propyl 2-[5-[(butylsulfonylamino)methyl]thiophen-2-yl]acetate.
| Compound Name | propyl 2-[5-[(butylsulfonylamino)methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 58942892 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | propyl 2-[5-[(butylsulfonylamino)methyl]thiophen-2-yl]acetate |
| SMILES | CCCCS(=O)(=O)NCc1ccc(CC(=O)OCCC)s1 |
| InChI | InChI=1S/C14H23NO4S2/c1-3-5-9-21(17,18)15-11-13-7-6-12(20-13)10-14(16)19-8-4-2/h6-7,15H,3-5,8-11H2,1-2H3 |
| InChIKey | PDNMGAYVXCVBLV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |