C10H16ClNO4S3 — CID 63687132
5-[2-(tert-butylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride (PubChem CID 63687132) has the molecular formula C10H16ClNO4S3 and a molecular weight of 345.90 g/mol. Its IUPAC name is 5-[2-(tert-butylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(tert-butylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 63687132 |
| Molecular Formula | C10H16ClNO4S3 |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 5-[2-(tert-butylsulfonylamino)ethyl]thiophene-2-sulfonyl chloride |
| SMILES | CC(C)(C)S(=O)(=O)NCCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C10H16ClNO4S3/c1-10(2,3)19(15,16)12-7-6-8-4-5-9(17-8)18(11,13)14/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | UPSYJRKSHJOLBF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |