C10H12ClN3O4S3 — CID 104709821
5-[2-[(2-methylpyrazol-3-yl)sulfonylamino]ethyl]thiophene-2-sulfonyl chloride (PubChem CID 104709821) has the molecular formula C10H12ClN3O4S3 and a molecular weight of 369.88 g/mol. Its IUPAC name is 5-[2-[(2-methylpyrazol-3-yl)sulfonylamino]ethyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-[(2-methylpyrazol-3-yl)sulfonylamino]ethyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 104709821 |
| Molecular Formula | C10H12ClN3O4S3 |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 5-[2-[(2-methylpyrazol-3-yl)sulfonylamino]ethyl]thiophene-2-sulfonyl chloride |
| SMILES | Cn1nccc1S(=O)(=O)NCCc1ccc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C10H12ClN3O4S3/c1-14-9(5-6-12-14)21(17,18)13-7-4-8-2-3-10(19-8)20(11,15)16/h2-3,5-6,13H,4,7H2,1H3 |
| InChIKey | MITYWMOAMQVIRU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |