C15H28N2O2S2 — CID 103466053
N-(2,2-dimethylbutyl)-5-[2-(propylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 103466053) has the molecular formula C15H28N2O2S2 and a molecular weight of 332.54 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-5-[2-(propylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-(2,2-dimethylbutyl)-5-[2-(propylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103466053 |
| Molecular Formula | C15H28N2O2S2 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-(2,2-dimethylbutyl)-5-[2-(propylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CCCNCCc1ccc(S(=O)(=O)NCC(C)(C)CC)s1 |
| InChI | InChI=1S/C15H28N2O2S2/c1-5-10-16-11-9-13-7-8-14(20-13)21(18,19)17-12-15(3,4)6-2/h7-8,16-17H,5-6,9-12H2,1-4H3 |
| InChIKey | NPFQYUSSMDYSEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|