C12H18N2O4S2 — CID 64553058
4-[3-(cyclopropylsulfonylamino)propyl]benzenesulfonamide (PubChem CID 64553058) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[3-(cyclopropylsulfonylamino)propyl]benzenesulfonamide.
| Compound Name | 4-[3-(cyclopropylsulfonylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64553058 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-[3-(cyclopropylsulfonylamino)propyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCCNS(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C12H18N2O4S2/c13-19(15,16)11-5-3-10(4-6-11)2-1-9-14-20(17,18)12-7-8-12/h3-6,12,14H,1-2,7-9H2,(H2,13,15,16) |
| InChIKey | CTMCDESKIZGKOA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|