C17H22N2O4S2 — CID 110293809
4-[3-[(2-methylphenyl)methylsulfonylamino]propyl]benzenesulfonamide (PubChem CID 110293809) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-[3-[(2-methylphenyl)methylsulfonylamino]propyl]benzenesulfonamide.
| Compound Name | 4-[3-[(2-methylphenyl)methylsulfonylamino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110293809 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-[3-[(2-methylphenyl)methylsulfonylamino]propyl]benzenesulfonamide |
| SMILES | Cc1ccccc1CS(=O)(=O)NCCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-14-5-2-3-7-16(14)13-24(20,21)19-12-4-6-15-8-10-17(11-9-15)25(18,22)23/h2-3,5,7-11,19H,4,6,12-13H2,1H3,(H2,18,22,23) |
| InChIKey | JTPSDPOIDGVFHA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|