C17H22N2O5S2 — CID 110293800
4-methoxy-2-methyl-N-[3-(4-sulfamoylphenyl)propyl]benzenesulfonamide (PubChem CID 110293800) has the molecular formula C17H22N2O5S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[3-(4-sulfamoylphenyl)propyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[3-(4-sulfamoylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110293800 |
| Molecular Formula | C17H22N2O5S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-methoxy-2-methyl-N-[3-(4-sulfamoylphenyl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCc2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C17H22N2O5S2/c1-13-12-15(24-2)7-10-17(13)26(22,23)19-11-3-4-14-5-8-16(9-6-14)25(18,20)21/h5-10,12,19H,3-4,11H2,1-2H3,(H2,18,20,21) |
| InChIKey | SNMBFMCECQIZQR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|