C12H20N2O4S2 — CID 60906181
4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonamide (PubChem CID 60906181) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonamide.
| Compound Name | 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60906181 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-10(2)20(17,18)14-9-3-4-11-5-7-12(8-6-11)19(13,15)16/h5-8,10,14H,3-4,9H2,1-2H3,(H2,13,15,16) |
| InChIKey | BLTWLCKIFAEDBD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|