C16H29N3O4S2 — CID 70939640
4-[2-[5-(propan-2-ylsulfonylamino)pentylamino]ethyl]benzenesulfonamide (PubChem CID 70939640) has the molecular formula C16H29N3O4S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-[2-[5-(propan-2-ylsulfonylamino)pentylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[5-(propan-2-ylsulfonylamino)pentylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70939640 |
| Molecular Formula | C16H29N3O4S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[2-[5-(propan-2-ylsulfonylamino)pentylamino]ethyl]benzenesulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H29N3O4S2/c1-14(2)25(22,23)19-12-5-3-4-11-18-13-10-15-6-8-16(9-7-15)24(17,20)21/h6-9,14,18-19H,3-5,10-13H2,1-2H3,(H2,17,20,21) |
| InChIKey | KTTZGTGTPMZCFR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|