C12H18ClNO4S2 — CID 60905145
4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonyl chloride (PubChem CID 60905145) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonyl chloride.
| Compound Name | 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 60905145 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-[3-(propan-2-ylsulfonylamino)propyl]benzenesulfonyl chloride |
| SMILES | CC(C)S(=O)(=O)NCCCc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO4S2/c1-10(2)20(17,18)14-9-3-4-11-5-7-12(8-6-11)19(13,15)16/h5-8,10,14H,3-4,9H2,1-2H3 |
| InChIKey | SSSIYXRWLVTVDJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|