C20H25NO4S — CID 110314204
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-1-(2-methylphenyl)methanesulfonamide (PubChem CID 110314204) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-1-(2-methylphenyl)methanesulfonamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-1-(2-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110314204 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-1-(2-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccccc1CS(=O)(=O)NCCCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H25NO4S/c1-16-6-2-3-8-18(16)15-26(22,23)21-11-5-4-7-17-9-10-19-20(14-17)25-13-12-24-19/h2-3,6,8-10,14,21H,4-5,7,11-13,15H2,1H3 |
| InChIKey | YDNSFLKTIVWUIC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|