C20H24FNO4S — CID 110312242
N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-2-(2-fluorophenyl)ethanesulfonamide (PubChem CID 110312242) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-2-(2-fluorophenyl)ethanesulfonamide.
| Compound Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-2-(2-fluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110312242 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)butyl]-2-(2-fluorophenyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1F)NCCCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H24FNO4S/c21-18-7-2-1-6-17(18)10-14-27(23,24)22-11-4-3-5-16-8-9-19-20(15-16)26-13-12-25-19/h1-2,6-9,15,22H,3-5,10-14H2 |
| InChIKey | JJLDCNPAAICZJZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|