C19H20FN3O3S — CID 110310723
2-(2-fluorophenyl)-N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]ethanesulfonamide (PubChem CID 110310723) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]ethanesulfonamide.
| Compound Name | 2-(2-fluorophenyl)-N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 110310723 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccc1F)NCCCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H20FN3O3S/c20-17-10-5-4-7-15(17)12-14-27(24,25)21-13-6-11-18-22-19(23-26-18)16-8-2-1-3-9-16/h1-5,7-10,21H,6,11-14H2 |
| InChIKey | MZIRDELRJAJMTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|