C11H17N3O3S2 — CID 113224273
N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyrrolidine-1-carboxamide (PubChem CID 113224273) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 113224273 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[2-(5-sulfamoylthiophen-2-yl)ethyl]pyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C11H17N3O3S2/c12-19(16,17)10-4-3-9(18-10)5-6-13-11(15)14-7-1-2-8-14/h3-4H,1-2,5-8H2,(H,13,15)(H2,12,16,17) |
| InChIKey | TYWNQPIIPIPECE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |