C28H30N8O12S — CID 142767182
bis[2-[(5-hydroxy-4-oxo-1H-pyridin-2-yl)methylcarbamoyl]-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 142767182) has the molecular formula C28H30N8O12S and a molecular weight of 702.66 g/mol. Its IUPAC name is bis[2-[(5-hydroxy-4-oxo-1H-pyridin-2-yl)methylcarbamoyl]-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | bis[2-[(5-hydroxy-4-oxo-1H-pyridin-2-yl)methylcarbamoyl]-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 142767182 |
| Molecular Formula | C28H30N8O12S |
| Molecular Weight | 702.66 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | bis[2-[(5-hydroxy-4-oxo-1H-pyridin-2-yl)methylcarbamoyl]-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | CC1=CC(C(=O)NCc2cc(=O)c(O)c[nH]2)N2CC1N(OS(=O)(=O)ON1C(=O)N3CC1C(C)=CC3C(=O)NCc1cc(=O)c(O)c[nH]1)C2=O |
| InChI | InChI=1S/C28H30N8O12S/c1-13-3-17(25(41)31-7-15-5-21(37)23(39)9-29-15)33-11-19(13)35(27(33)43)47-49(45,46)48-36-20-12-34(28(36)44)18(4-14(20)2)26(42)32-8-16-6-22(38)24(40)10-30-16/h3-6,9-10,17-20,39-40H,7-8,11-12H2,1-2H3,(H,29,37)(H,30,38)(H,31,41)(H,32,42) |
| InChIKey | REOWUGAYPLQWFF-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 264.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.66 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|