C11H16N3O5P2S- — CID 158599142
[(2S,5R)-2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate;phosphanyl-[(E)-prop-1-enyl]phosphane (PubChem CID 158599142) has the molecular formula C11H16N3O5P2S- and a molecular weight of 364.28 g/mol. Its IUPAC name is [(2S,5R)-2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate;phosphanyl-[(E)-prop-1-enyl]phosphane.
| Compound Name | [(2S,5R)-2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate;phosphanyl-[(E)-prop-1-enyl]phosphane |
|---|---|
| PubChem CID | 158599142 |
| Molecular Formula | C11H16N3O5P2S- |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [(2S,5R)-2-cyano-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate;phosphanyl-[(E)-prop-1-enyl]phosphane |
| SMILES | C/C=C/PP.CC1=C[C@@H](C#N)N2C[C@@H]1N(OS(=O)(=O)[O-])C2=O |
| InChI | InChI=1S/C8H9N3O5S.C3H8P2/c1-5-2-6(3-9)10-4-7(5)11(8(10)12)16-17(13,14)15;1-2-3-5-4/h2,6-7H,4H2,1H3,(H,13,14,15);2-3,5H,4H2,1H3/p-1/b;3-2+/t6-,7-;/m0./s1 |
| InChIKey | HVKHUVDKPFGUIT-AZWHFLGPSA-M |
| XLogP | 1.33 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|