C15H16N6O7S — CID 69150341
(4,7-dicarbamoyl-9-oxo-5-phenyl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undec-2(6)-en-10-yl) hydrogen sulfate (PubChem CID 69150341) has the molecular formula C15H16N6O7S and a molecular weight of 424.40 g/mol. Its IUPAC name is (4,7-dicarbamoyl-9-oxo-5-phenyl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undec-2(6)-en-10-yl) hydrogen sulfate.
| Compound Name | (4,7-dicarbamoyl-9-oxo-5-phenyl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undec-2(6)-en-10-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 69150341 |
| Molecular Formula | C15H16N6O7S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (4,7-dicarbamoyl-9-oxo-5-phenyl-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undec-2(6)-en-10-yl) hydrogen sulfate |
| SMILES | NC(=O)C1C2=C(CN(C(N)=O)N2c2ccccc2)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H16N6O7S/c16-13(22)12-11-9(10-7-18(12)15(24)21(10)28-29(25,26)27)6-19(14(17)23)20(11)8-4-2-1-3-5-8/h1-5,10,12H,6-7H2,(H2,16,22)(H2,17,23)(H,25,26,27) |
| InChIKey | CPWQFEVUUYJWAR-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 179.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|