C14H13N5O3S — CID 87625912
9-oxo-4-phenyl-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxamide (PubChem CID 87625912) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 9-oxo-4-phenyl-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxamide.
| Compound Name | 9-oxo-4-phenyl-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxamide |
|---|---|
| PubChem CID | 87625912 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 9-oxo-4-phenyl-10-sulfanyloxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-diene-7-carboxamide |
| SMILES | NC(=O)C1c2nn(-c3ccccc3)cc2C2CN1C(=O)N2OS |
| InChI | InChI=1S/C14H13N5O3S/c15-13(20)12-11-9(10-7-17(12)14(21)19(10)22-23)6-18(16-11)8-4-2-1-3-5-8/h1-6,10,12,23H,7H2,(H2,15,20) |
| InChIKey | GIIYZCDBJYPRKO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|