C19H30N8O6 — CID 146626039
tert-butyl N-[2-[[2-[[C-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-methylcarbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate (PubChem CID 146626039) has the molecular formula C19H30N8O6 and a molecular weight of 466.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[C-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-methylcarbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[C-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-methylcarbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 146626039 |
| Molecular Formula | C19H30N8O6 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | tert-butyl N-[2-[[2-[[C-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-N-methylcarbonimidoyl]amino]oxyacetyl]amino]ethyl]carbamate |
| SMILES | C/N=C(\NOCC(=O)NCCNC(=O)OC(C)(C)C)[C@@H]1c2c(cnn2C)[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C19H30N8O6/c1-19(2,3)33-17(29)22-7-6-21-13(28)10-32-24-16(20-4)15-14-11(8-23-25(14)5)12-9-26(15)18(30)27(12)31/h8,12,15,31H,6-7,9-10H2,1-5H3,(H,20,24)(H,21,28)(H,22,29)/t12-,15-/m0/s1 |
| InChIKey | GZIGZJFBTPCHCF-WFASDCNBSA-N |
| XLogP | -0.17 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|