C24H43N7O5Si — CID 150040356
tert-butyl N-[4-[(1R,7S)-7-[N-[tert-butyl(dimethyl)silyl]oxy-N-methylcarbamimidoyl]-10-hydroxy-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl]butyl]carbamate (PubChem CID 150040356) has the molecular formula C24H43N7O5Si and a molecular weight of 537.74 g/mol. Its IUPAC name is tert-butyl N-[4-[(1R,7S)-7-[N-[tert-butyl(dimethyl)silyl]oxy-N-methylcarbamimidoyl]-10-hydroxy-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1R,7S)-7-[N-[tert-butyl(dimethyl)silyl]oxy-N-methylcarbamimidoyl]-10-hydroxy-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl]butyl]carbamate |
|---|---|
| PubChem CID | 150040356 |
| Molecular Formula | C24H43N7O5Si |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | tert-butyl N-[4-[(1R,7S)-7-[N-[tert-butyl(dimethyl)silyl]oxy-N-methylcarbamimidoyl]-10-hydroxy-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-5-yl]butyl]carbamate |
| SMILES | [H]/N=C(/[C@@H]1c2c(cnn2CCCCNC(=O)OC(C)(C)C)[C@@H]2CN1C(=O)N2O)N(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43N7O5Si/c1-23(2,3)35-21(32)26-12-10-11-13-30-18-16(14-27-30)17-15-29(22(33)31(17)34)19(18)20(25)28(7)36-37(8,9)24(4,5)6/h14,17,19,25,34H,10-13,15H2,1-9H3,(H,26,32)/b25-20-/t17-,19-/m0/s1 |
| InChIKey | DJDMVHCQTNWXTG-MQOGRCKRSA-N |
| XLogP | 4.26 |
| TPSA | 136.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|